7,8-dichloro-2-methylquinolin-4-amine
Catalog No: FT-0716820
CAS No: 917562-02-8
- Chemical Name: 7,8-dichloro-2-methylquinolin-4-amine
- Molecular Formula: C10H8Cl2N2
- Molecular Weight: 227.09
- InChI Key: YOXFYSBUBIJKKS-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8Cl2N2/c1-5-4-8(13)6-2-3-7(11)9(12)10(6)14-5/h2-4H,1H3,(H2,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 917562-02-8 |
|---|---|
| MF: | C10H8Cl2N2 |
| Density: | 1.426g/cm3 |
| Flash_Point: | 192.8ºC |
| Melting_Point: | N/A |
| Product_Name: | 7,8-dichloro-2-methylquinolin-4-amine |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 395.1ºC at 760 mmHg |
| FW: | 227.09000 |
| Density: | 1.426g/cm3 |
|---|---|
| MF: | C10H8Cl2N2 |
| LogP: | 4.01340 |
| Exact_Mass: | 226.00600 |
| Bolling_Point: | 395.1ºC at 760 mmHg |
| Flash_Point: | 192.8ºC |
| FW: | 227.09000 |
| Refractive_Index: | 1.692 |
| PSA: | 38.91000 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Safety_Statements: | H302-H318 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)